| Name | 2,4,6-Trimethylbenzoic acid |
| Synonyms | TMBA Mesitoic acid beta-isodurylicacid RARECHEM AL BO 0328 beta-Isodurylic acid 2,4,6-trimethylbenzoate Mesitylenecarboxylic acid 2,4,6-trimethyl-benzoicaci 2,4,6-Trimethylbenzoic acid 2,4,6-TRIMETHYLBENZOIC ACID 2-MESITYLENECARBOXYLIC ACID 2,4,6-Trimethyl Benzoic Acid Benzoicacid,2,4,6-trimethyl- Mesitylene-2-carboxylic acid |
| CAS | 480-63-7 |
| EINECS | 207-553-9 |
| InChI | InChI=1/C10H12O2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3,(H,11,12)/p-1 |
| InChIKey | FFFIRKXTFQCCKJ-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
| Molar Mass | 164.2 |
| Density | 1.0670 (estimate) |
| Melting Point | 152-155 °C (lit.) |
| Boling Point | 288.61°C (estimate) |
| Flash Point | 138°C |
| Water Solubility | 722.5mg/L(temperature not stated) |
| Solubility | Chlorform (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.000639mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| BRN | 1866187 |
| pKa | pK1:3.448 (25°C) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5198 (estimate) |
| Physical and Chemical Properties | Melting point 153-155°C |
| Use | It can be used as an intermediate for dyes, pesticides, medicines and photoinitiators, and can be used for the synthesis of trimethylbenzoyl chloride, etc. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | DI0887010 |
| TSCA | Yes |
| HS Code | 29163900 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | Used as an intermediate for dyes, pesticides, medicines and photoinitiators, and can be used to synthesize trimethylbenzoyl chloride, etc. |